C18H23ClFNO2 — CID 69464712
1-[3-[(2-chloro-6-fluorophenyl)methyl]-4-(hydroxymethyl)cyclohexyl]pyrrolidin-2-one (PubChem CID 69464712) has the molecular formula C18H23ClFNO2 and a molecular weight of 339.84 g/mol. Its IUPAC name is 1-[3-[(2-chloro-6-fluorophenyl)methyl]-4-(hydroxymethyl)cyclohexyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(2-chloro-6-fluorophenyl)methyl]-4-(hydroxymethyl)cyclohexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69464712 |
| Molecular Formula | C18H23ClFNO2 |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[3-[(2-chloro-6-fluorophenyl)methyl]-4-(hydroxymethyl)cyclohexyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1CCC(CO)C(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C18H23ClFNO2/c19-16-3-1-4-17(20)15(16)10-13-9-14(7-6-12(13)11-22)21-8-2-5-18(21)23/h1,3-4,12-14,22H,2,5-11H2 |
| InChIKey | DPRYVTGXPGMEFT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |