C18H23ClFNO — CID 69466460
1-[3-[(2-chloro-6-fluorophenyl)methyl]cyclohexyl]piperidin-2-one (PubChem CID 69466460) has the molecular formula C18H23ClFNO and a molecular weight of 323.84 g/mol. Its IUPAC name is 1-[3-[(2-chloro-6-fluorophenyl)methyl]cyclohexyl]piperidin-2-one.
| Compound Name | 1-[3-[(2-chloro-6-fluorophenyl)methyl]cyclohexyl]piperidin-2-one |
|---|---|
| PubChem CID | 69466460 |
| Molecular Formula | C18H23ClFNO |
| Molecular Weight | 323.84 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[3-[(2-chloro-6-fluorophenyl)methyl]cyclohexyl]piperidin-2-one |
| SMILES | O=C1CCCCN1C1CCCC(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C18H23ClFNO/c19-16-7-4-8-17(20)15(16)12-13-5-3-6-14(11-13)21-10-2-1-9-18(21)22/h4,7-8,13-14H,1-3,5-6,9-12H2 |
| InChIKey | SJTWZUFXRSAWJO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |