C25H18F3N3O5 — CID 69467038
4-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 69467038) has the molecular formula C25H18F3N3O5 and a molecular weight of 497.43 g/mol. Its IUPAC name is 4-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 69467038 |
| Molecular Formula | C25H18F3N3O5 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)N=C2C)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18F3N3O5/c1-15-19(24(32)30(29-15)18-6-4-3-5-7-18)12-16-8-10-22(23(13-16)35-2)36-21-11-9-17(25(26,27)28)14-20(21)31(33)34/h3-14H,1-2H3 |
| InChIKey | QCMSOFVQRQIGJK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|