C12H14BrNO — CID 69469816
(3S,4R)-6-bromo-4-prop-2-enyl-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 69469816) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is (3S,4R)-6-bromo-4-prop-2-enyl-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | (3S,4R)-6-bromo-4-prop-2-enyl-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 69469816 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (3S,4R)-6-bromo-4-prop-2-enyl-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | C=CC[C@@H]1c2cc(Br)ccc2NC[C@H]1O |
| InChI | InChI=1S/C12H14BrNO/c1-2-3-9-10-6-8(13)4-5-11(10)14-7-12(9)15/h2,4-6,9,12,14-15H,1,3,7H2/t9-,12-/m1/s1 |
| InChIKey | XLJRXLFTOIEHHF-BXKDBHETSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|