C28H33ClN4O4 — CID 69475326
tert-butyl N-[2-[1-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)propyl-prop-2-enoylamino]ethyl]carbamate (PubChem CID 69475326) has the molecular formula C28H33ClN4O4 and a molecular weight of 525.05 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)propyl-prop-2-enoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)propyl-prop-2-enoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 69475326 |
| Molecular Formula | C28H33ClN4O4 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | tert-butyl N-[2-[1-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)propyl-prop-2-enoylamino]ethyl]carbamate |
| SMILES | C=CC(=O)N(CCNC(=O)OC(C)(C)C)C(CC)c1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C28H33ClN4O4/c1-6-23(32(24(34)7-2)16-15-30-27(36)37-28(3,4)5)25-31-22-17-20(29)13-14-21(22)26(35)33(25)18-19-11-9-8-10-12-19/h7-14,17,23H,2,6,15-16,18H2,1,3-5H3,(H,30,36) |
| InChIKey | PSYJPMZTRYOSIX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|