C15H17F2N3O3S — CID 69475435
3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 69475435) has the molecular formula C15H17F2N3O3S and a molecular weight of 357.38 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 69475435 |
| Molecular Formula | C15H17F2N3O3S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | NC(=O)C1CN(c2cc(F)c(C3CCCSNC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H17F2N3O3S/c16-10-4-9(20-7-12(14(18)21)23-15(20)22)5-11(17)13(10)8-2-1-3-24-19-6-8/h4-5,8,12,19H,1-3,6-7H2,(H2,18,21) |
| InChIKey | ZJPUELKXNAQOPA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|