C16H18F2N2O4S — CID 69467235
methyl 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 69467235) has the molecular formula C16H18F2N2O4S and a molecular weight of 372.39 g/mol. Its IUPAC name is methyl 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 69467235 |
| Molecular Formula | C16H18F2N2O4S |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | methyl 3-[3,5-difluoro-4-(thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)C1CN(c2cc(F)c(C3CCCSNC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H18F2N2O4S/c1-23-15(21)13-8-20(16(22)24-13)10-5-11(17)14(12(18)6-10)9-3-2-4-25-19-7-9/h5-6,9,13,19H,2-4,7-8H2,1H3 |
| InChIKey | CKAWWKRESZSLSU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|