C23H33N3O — CID 69481058
[5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-(3-propan-2-ylcyclohexen-1-yl)methanone (PubChem CID 69481058) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-(3-propan-2-ylcyclohexen-1-yl)methanone.
| Compound Name | [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-(3-propan-2-ylcyclohexen-1-yl)methanone |
|---|---|
| PubChem CID | 69481058 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-(3-propan-2-ylcyclohexen-1-yl)methanone |
| SMILES | CC(C)C1C=C(C(=O)N2Cc3ccc(N4CCN(C)CC4)cc3C2)CCC1 |
| InChI | InChI=1S/C23H33N3O/c1-17(2)18-5-4-6-19(13-18)23(27)26-15-20-7-8-22(14-21(20)16-26)25-11-9-24(3)10-12-25/h7-8,13-14,17-18H,4-6,9-12,15-16H2,1-3H3 |
| InChIKey | HCLJCESPAAPBLI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|