C22H26ClN3O5S — CID 69489816
ethyl N-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]carbamate (PubChem CID 69489816) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is ethyl N-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69489816 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl N-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(CN(C2CCCCNC2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClN3O5S/c1-2-31-22(28)25-18-10-6-16(7-11-18)15-26(20-5-3-4-14-24-21(20)27)32(29,30)19-12-8-17(23)9-13-19/h6-13,20H,2-5,14-15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | SNQYBVVIOCMNJH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |