C20H22N4O3 — CID 69492162
(8R)-6,7-dihydroxy-N,2,3-trimethyl-8-phenyl-6,7,8,9-tetrahydroimidazo[4,5-h]quinoline-5-carboxamide (PubChem CID 69492162) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (8R)-6,7-dihydroxy-N,2,3-trimethyl-8-phenyl-6,7,8,9-tetrahydroimidazo[4,5-h]quinoline-5-carboxamide.
| Compound Name | (8R)-6,7-dihydroxy-N,2,3-trimethyl-8-phenyl-6,7,8,9-tetrahydroimidazo[4,5-h]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 69492162 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (8R)-6,7-dihydroxy-N,2,3-trimethyl-8-phenyl-6,7,8,9-tetrahydroimidazo[4,5-h]quinoline-5-carboxamide |
| SMILES | CNC(=O)c1cc2c(nc(C)n2C)c2c1C(O)C(O)[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H22N4O3/c1-10-22-16-13(24(10)3)9-12(20(27)21-2)14-17(16)23-15(19(26)18(14)25)11-7-5-4-6-8-11/h4-9,15,18-19,23,25-26H,1-3H3,(H,21,27)/t15-,18?,19?/m1/s1 |
| InChIKey | KGPBGEGXYZHQRZ-VNCLNFNDSA-N |
| XLogP | 1.80 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |