C24H32N7O4+ — CID 69492634
1-amino-N-(3,5-dimethoxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)anilino]-1,2,4-triazol-1-ium-1-carboxamide (PubChem CID 69492634) has the molecular formula C24H32N7O4+ and a molecular weight of 482.57 g/mol. Its IUPAC name is 1-amino-N-(3,5-dimethoxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)anilino]-1,2,4-triazol-1-ium-1-carboxamide.
| Compound Name | 1-amino-N-(3,5-dimethoxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)anilino]-1,2,4-triazol-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 69492634 |
| Molecular Formula | C24H32N7O4+ |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 1-amino-N-(3,5-dimethoxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)anilino]-1,2,4-triazol-1-ium-1-carboxamide |
| SMILES | COc1cc(NC(=O)[N+]2(N)C=NC(Nc3ccc(OCCN4CCCCC4)cc3)=N2)cc(OC)c1 |
| InChI | InChI=1S/C24H31N7O4/c1-33-21-14-19(15-22(16-21)34-2)28-24(32)31(25)17-26-23(29-31)27-18-6-8-20(9-7-18)35-13-12-30-10-4-3-5-11-30/h6-9,14-17H,3-5,10-13,25H2,1-2H3,(H-,27,28,29,32)/p+1 |
| InChIKey | QICQWDFHCHKHBI-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|