C13H20O2 — CID 6953700
(1R,2R,6R,8S,14S)-13-oxatetracyclo[6.4.1.12,6.01,8]tetradecan-14-ol (PubChem CID 6953700) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2R,6R,8S,14S)-13-oxatetracyclo[6.4.1.12,6.01,8]tetradecan-14-ol.
| Compound Name | (1R,2R,6R,8S,14S)-13-oxatetracyclo[6.4.1.12,6.01,8]tetradecan-14-ol |
|---|---|
| PubChem CID | 6953700 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2R,6R,8S,14S)-13-oxatetracyclo[6.4.1.12,6.01,8]tetradecan-14-ol |
| SMILES | O[C@H]1[C@@H]2CCC[C@H]1[C@]13CCCC[C@@]1(C2)O3 |
| InChI | InChI=1S/C13H20O2/c14-11-9-4-3-5-10(11)13-7-2-1-6-12(13,8-9)15-13/h9-11,14H,1-8H2/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | OCNPBDJCVJYMKL-NAWOPXAZSA-N |
| XLogP | 2.25 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|