C15H19N4O+ — CID 6955520
dimethyl-[3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)propyl]azanium (PubChem CID 6955520) has the molecular formula C15H19N4O+ and a molecular weight of 271.34 g/mol. Its IUPAC name is dimethyl-[3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)propyl]azanium.
| Compound Name | dimethyl-[3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)propyl]azanium |
|---|---|
| PubChem CID | 6955520 |
| Molecular Formula | C15H19N4O+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | dimethyl-[3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)propyl]azanium |
| SMILES | C[NH+](C)CCCn1cnc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C15H18N4O/c1-18(2)8-5-9-19-10-16-13-11-6-3-4-7-12(11)17-14(13)15(19)20/h3-4,6-7,10,17H,5,8-9H2,1-2H3/p+1 |
| InChIKey | MTRWXJSRWLUEIZ-UHFFFAOYSA-O |
| XLogP | 0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |