C16H18N4O2 — CID 53028163
3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-propan-2-ylpropanamide (PubChem CID 53028163) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-propan-2-ylpropanamide.
| Compound Name | 3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 53028163 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCn1cnc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C16H18N4O2/c1-10(2)18-13(21)7-8-20-9-17-14-11-5-3-4-6-12(11)19-15(14)16(20)22/h3-6,9-10,19H,7-8H2,1-2H3,(H,18,21) |
| InChIKey | GPFIWGIXQRUSLS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |