C18H20N4O2 — CID 18525531
N-cyclohexyl-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide (PubChem CID 18525531) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 18525531 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-cyclohexyl-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2c([nH]c3ccccc32)c1=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H20N4O2/c23-15(20-12-6-2-1-3-7-12)10-22-11-19-16-13-8-4-5-9-14(13)21-17(16)18(22)24/h4-5,8-9,11-12,21H,1-3,6-7,10H2,(H,20,23) |
| InChIKey | YIBTVGZSTDVFHS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |