C10H22N2+2 — CID 6955846
1-(cyclopentylmethyl)piperazine-1,4-diium (PubChem CID 6955846) has the molecular formula C10H22N2+2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)piperazine-1,4-diium.
| Compound Name | 1-(cyclopentylmethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 6955846 |
| Molecular Formula | C10H22N2+2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-(cyclopentylmethyl)piperazine-1,4-diium |
| SMILES | C1CCC(C[NH+]2CC[NH2+]CC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-2-4-10(3-1)9-12-7-5-11-6-8-12/h10-11H,1-9H2/p+2 |
| InChIKey | HDSJFNAPZZCQAT-UHFFFAOYSA-P |
| XLogP | -1.36 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |