C23H28N3O+ — CID 6962287
[2-[(2-ethyl-3-methylquinolin-4-yl)amino]-2-oxoethyl]-[(2R)-1-phenylpropan-2-yl]azanium (PubChem CID 6962287) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is [2-[(2-ethyl-3-methylquinolin-4-yl)amino]-2-oxoethyl]-[(2R)-1-phenylpropan-2-yl]azanium.
| Compound Name | [2-[(2-ethyl-3-methylquinolin-4-yl)amino]-2-oxoethyl]-[(2R)-1-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 6962287 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [2-[(2-ethyl-3-methylquinolin-4-yl)amino]-2-oxoethyl]-[(2R)-1-phenylpropan-2-yl]azanium |
| SMILES | CCc1nc2ccccc2c(NC(=O)C[NH2+][C@H](C)Cc2ccccc2)c1C |
| InChI | InChI=1S/C23H27N3O/c1-4-20-17(3)23(19-12-8-9-13-21(19)25-20)26-22(27)15-24-16(2)14-18-10-6-5-7-11-18/h5-13,16,24H,4,14-15H2,1-3H3,(H,25,26,27)/p+1/t16-/m1/s1 |
| InChIKey | YHPPORWARGLPBZ-MRXNPFEDSA-O |
| XLogP | 3.24 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |