C15H17BrClN2S+ — CID 6962456
1-[(4-bromothiophen-2-yl)methyl]-4-(4-chlorophenyl)piperazin-1-ium (PubChem CID 6962456) has the molecular formula C15H17BrClN2S+ and a molecular weight of 372.74 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-4-(4-chlorophenyl)piperazin-1-ium.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-4-(4-chlorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6962456 |
| Molecular Formula | C15H17BrClN2S+ |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-4-(4-chlorophenyl)piperazin-1-ium |
| SMILES | Clc1ccc(N2CC[NH+](Cc3cc(Br)cs3)CC2)cc1 |
| InChI | InChI=1S/C15H16BrClN2S/c16-12-9-15(20-11-12)10-18-5-7-19(8-6-18)14-3-1-13(17)2-4-14/h1-4,9,11H,5-8,10H2/p+1 |
| InChIKey | SNMRDMOPEGPAOI-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |