C28H26N3O3+ — CID 6967858
2-[(2S)-1-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 6967858) has the molecular formula C28H26N3O3+ and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[(2S)-1-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6967858 |
| Molecular Formula | C28H26N3O3+ |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2-[(2S)-1-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | C[C@@H](C(=O)N1CC[NH+](C2c3ccccc3-c3ccccc32)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H25N3O3/c1-18(31-27(33)23-12-6-7-13-24(23)28(31)34)26(32)30-16-14-29(15-17-30)25-21-10-4-2-8-19(21)20-9-3-5-11-22(20)25/h2-13,18,25H,14-17H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | XLJWDUQENLBQQP-SFHVURJKSA-O |
| XLogP | 2.17 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|