C25H22FN5+2 — CID 6973877
[(7R,8S,8aS)-2-benzyl-5,5,7-tricyano-8-(3-fluorophenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-6-ylidene]azanium (PubChem CID 6973877) has the molecular formula C25H22FN5+2 and a molecular weight of 411.48 g/mol. Its IUPAC name is [(7R,8S,8aS)-2-benzyl-5,5,7-tricyano-8-(3-fluorophenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-6-ylidene]azanium.
| Compound Name | [(7R,8S,8aS)-2-benzyl-5,5,7-tricyano-8-(3-fluorophenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-6-ylidene]azanium |
|---|---|
| PubChem CID | 6973877 |
| Molecular Formula | C25H22FN5+2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [(7R,8S,8aS)-2-benzyl-5,5,7-tricyano-8-(3-fluorophenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-6-ylidene]azanium |
| SMILES | N#C[C@H]1C(=[NH2+])C(C#N)(C#N)C2=CC[NH+](Cc3ccccc3)C[C@H]2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C25H20FN5/c26-19-8-4-7-18(11-19)23-20(12-27)24(30)25(15-28,16-29)22-9-10-31(14-21(22)23)13-17-5-2-1-3-6-17/h1-9,11,20-21,23,30H,10,13-14H2/p+2/t20-,21-,23-/m1/s1 |
| InChIKey | QHMVYWHTGUJIBF-MQSCRBSSSA-P |
| XLogP | 0.94 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|