C22H24O6S — CID 6974598
(3-methylphenyl) 2-[(3R,4S)-4-[2-(3-methylphenoxy)-2-oxoethyl]-1,1-dioxothiolan-3-yl]acetate (PubChem CID 6974598) has the molecular formula C22H24O6S and a molecular weight of 416.50 g/mol. Its IUPAC name is (3-methylphenyl) 2-[(3R,4S)-4-[2-(3-methylphenoxy)-2-oxoethyl]-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | (3-methylphenyl) 2-[(3R,4S)-4-[2-(3-methylphenoxy)-2-oxoethyl]-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 6974598 |
| Molecular Formula | C22H24O6S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3-methylphenyl) 2-[(3R,4S)-4-[2-(3-methylphenoxy)-2-oxoethyl]-1,1-dioxothiolan-3-yl]acetate |
| SMILES | Cc1cccc(OC(=O)C[C@@H]2CS(=O)(=O)C[C@@H]2CC(=O)Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C22H24O6S/c1-15-5-3-7-19(9-15)27-21(23)11-17-13-29(25,26)14-18(17)12-22(24)28-20-8-4-6-16(2)10-20/h3-10,17-18H,11-14H2,1-2H3/t17-,18+ |
| InChIKey | YGVBGNLVITWKAE-HDICACEKSA-N |
| XLogP | 3.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|