C20H18N3O5S- — CID 6975263
3-[[(5S)-5-(N-(2-amino-2-oxoethyl)-4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 6975263) has the molecular formula C20H18N3O5S- and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-[[(5S)-5-(N-(2-amino-2-oxoethyl)-4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | 3-[[(5S)-5-(N-(2-amino-2-oxoethyl)-4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 6975263 |
| Molecular Formula | C20H18N3O5S- |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[[(5S)-5-(N-(2-amino-2-oxoethyl)-4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | Cc1ccc(N(CC(N)=O)[C@H]2SC(=O)N(Cc3cccc(C(=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O5S/c1-12-5-7-15(8-6-12)22(11-16(21)24)18-17(25)23(20(28)29-18)10-13-3-2-4-14(9-13)19(26)27/h2-9,18H,10-11H2,1H3,(H2,21,24)(H,26,27)/p-1/t18-/m0/s1 |
| InChIKey | ZMEXYPHYNNHILJ-SFHVURJKSA-M |
| XLogP | 0.87 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|