C19H19N3O3S — CID 7362246
2-(2-methyl-N-[(5R)-3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetamide (PubChem CID 7362246) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-(2-methyl-N-[(5R)-3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetamide.
| Compound Name | 2-(2-methyl-N-[(5R)-3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetamide |
|---|---|
| PubChem CID | 7362246 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-(2-methyl-N-[(5R)-3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetamide |
| SMILES | Cc1cccc(N2C(=O)S[C@@H](N(CC(N)=O)c3ccccc3C)C2=O)c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-12-6-5-8-14(10-12)22-17(24)18(26-19(22)25)21(11-16(20)23)15-9-4-3-7-13(15)2/h3-10,18H,11H2,1-2H3,(H2,20,23)/t18-/m1/s1 |
| InChIKey | QPWDSXYLEVFLOX-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|