C19H17NO2 — CID 6975620
(11R,15S,16S)-16-(furan-2-yl)-12-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8-pentaene (PubChem CID 6975620) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (11R,15S,16S)-16-(furan-2-yl)-12-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (11R,15S,16S)-16-(furan-2-yl)-12-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 6975620 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (11R,15S,16S)-16-(furan-2-yl)-12-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8-pentaene |
| SMILES | c1coc([C@H]2Nc3c(ccc4ccccc34)[C@@H]3OCC[C@@H]23)c1 |
| InChI | InChI=1S/C19H17NO2/c1-2-5-13-12(4-1)7-8-14-17(13)20-18(16-6-3-10-21-16)15-9-11-22-19(14)15/h1-8,10,15,18-20H,9,11H2/t15-,18-,19-/m0/s1 |
| InChIKey | MTKYIPYNZIGFMJ-SNRMKQJTSA-N |
| XLogP | 4.68 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |