C16H11NO2S — CID 86171740
3-(furan-2-yl)-1H-benzo[f][1,4]benzothiazin-2-one (PubChem CID 86171740) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-(furan-2-yl)-1H-benzo[f][1,4]benzothiazin-2-one.
| Compound Name | 3-(furan-2-yl)-1H-benzo[f][1,4]benzothiazin-2-one |
|---|---|
| PubChem CID | 86171740 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-(furan-2-yl)-1H-benzo[f][1,4]benzothiazin-2-one |
| SMILES | O=C1Nc2c(ccc3ccccc23)SC1c1ccco1 |
| InChI | InChI=1S/C16H11NO2S/c18-16-15(12-6-3-9-19-12)20-13-8-7-10-4-1-2-5-11(10)14(13)17-16/h1-9,15H,(H,17,18) |
| InChIKey | GUUSTCIXIJFIDD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |