C17H20NO4PS — CID 10618824
3-diethoxyphosphoryl-2-(furan-2-yl)-2,5-dihydro-1,5-benzothiazepine (PubChem CID 10618824) has the molecular formula C17H20NO4PS and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2-(furan-2-yl)-2,5-dihydro-1,5-benzothiazepine.
| Compound Name | 3-diethoxyphosphoryl-2-(furan-2-yl)-2,5-dihydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 10618824 |
| Molecular Formula | C17H20NO4PS |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-diethoxyphosphoryl-2-(furan-2-yl)-2,5-dihydro-1,5-benzothiazepine |
| SMILES | CCOP(=O)(OCC)C1=CNc2ccccc2SC1c1ccco1 |
| InChI | InChI=1S/C17H20NO4PS/c1-3-21-23(19,22-4-2)15-12-18-13-8-5-6-10-16(13)24-17(15)14-9-7-11-20-14/h5-12,17-18H,3-4H2,1-2H3 |
| InChIKey | RJSVGNZLYVNHSN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|