C11H16NO5PS — CID 72820389
4-diethoxyphosphoryl-5-(furan-2-yl)-1,3-oxazolidine-2-thione (PubChem CID 72820389) has the molecular formula C11H16NO5PS and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-5-(furan-2-yl)-1,3-oxazolidine-2-thione.
| Compound Name | 4-diethoxyphosphoryl-5-(furan-2-yl)-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 72820389 |
| Molecular Formula | C11H16NO5PS |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-diethoxyphosphoryl-5-(furan-2-yl)-1,3-oxazolidine-2-thione |
| SMILES | CCOP(=O)(OCC)C1NC(=S)OC1c1ccco1 |
| InChI | InChI=1S/C11H16NO5PS/c1-3-15-18(13,16-4-2)10-9(17-11(19)12-10)8-6-5-7-14-8/h5-7,9-10H,3-4H2,1-2H3,(H,12,19) |
| InChIKey | IOOJQJVFXLZINF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|