C11H22NO4PS — CID 134985673
5-tert-butyl-4-diethoxyphosphoryl-1,3-oxazolidine-2-thione (PubChem CID 134985673) has the molecular formula C11H22NO4PS and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-tert-butyl-4-diethoxyphosphoryl-1,3-oxazolidine-2-thione.
| Compound Name | 5-tert-butyl-4-diethoxyphosphoryl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 134985673 |
| Molecular Formula | C11H22NO4PS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-tert-butyl-4-diethoxyphosphoryl-1,3-oxazolidine-2-thione |
| SMILES | CCOP(=O)(OCC)C1NC(=S)OC1C(C)(C)C |
| InChI | InChI=1S/C11H22NO4PS/c1-6-14-17(13,15-7-2)9-8(11(3,4)5)16-10(18)12-9/h8-9H,6-7H2,1-5H3,(H,12,18) |
| InChIKey | CDFNUXHXKCXOLP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|