C13H19O6P — CID 10380171
(5S,6S)-5-diethoxyphosphoryl-6-(furan-2-yl)oxan-2-one (PubChem CID 10380171) has the molecular formula C13H19O6P and a molecular weight of 302.26 g/mol. Its IUPAC name is (5S,6S)-5-diethoxyphosphoryl-6-(furan-2-yl)oxan-2-one.
| Compound Name | (5S,6S)-5-diethoxyphosphoryl-6-(furan-2-yl)oxan-2-one |
|---|---|
| PubChem CID | 10380171 |
| Molecular Formula | C13H19O6P |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (5S,6S)-5-diethoxyphosphoryl-6-(furan-2-yl)oxan-2-one |
| SMILES | CCOP(=O)(OCC)[C@H]1CCC(=O)O[C@H]1c1ccco1 |
| InChI | InChI=1S/C13H19O6P/c1-3-17-20(15,18-4-2)11-7-8-12(14)19-13(11)10-6-5-9-16-10/h5-6,9,11,13H,3-4,7-8H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | SWWUKKRBEASREN-AAEUAGOBSA-N |
| XLogP | 3.29 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|