C12H11NO2 — CID 123642608
3-(furan-2-yl)-1,3,3a,4-tetrahydroindol-2-one (PubChem CID 123642608) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(furan-2-yl)-1,3,3a,4-tetrahydroindol-2-one.
| Compound Name | 3-(furan-2-yl)-1,3,3a,4-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 123642608 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-(furan-2-yl)-1,3,3a,4-tetrahydroindol-2-one |
| SMILES | O=C1NC2=CC=CCC2C1c1ccco1 |
| InChI | InChI=1S/C12H11NO2/c14-12-11(10-6-3-7-15-10)8-4-1-2-5-9(8)13-12/h1-3,5-8,11H,4H2,(H,13,14) |
| InChIKey | RNHQNJFGLGYUBS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |