C12H8N2O4S2 — CID 11889596
(1R,8S,9S)-8-(furan-2-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 11889596) has the molecular formula C12H8N2O4S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (1R,8S,9S)-8-(furan-2-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8S,9S)-8-(furan-2-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 11889596 |
| Molecular Formula | C12H8N2O4S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (1R,8S,9S)-8-(furan-2-yl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1NC(=O)[C@@H]2Sc3[nH]c(=O)sc3[C@H](c3ccco3)[C@@H]12 |
| InChI | InChI=1S/C12H8N2O4S2/c15-9-6-5(4-2-1-3-18-4)8-11(14-12(17)20-8)19-7(6)10(16)13-9/h1-3,5-7H,(H,14,17)(H,13,15,16)/t5-,6-,7-/m1/s1 |
| InChIKey | ZBSYMJOOCQVTLP-FSDSQADBSA-N |
| XLogP | 0.91 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|