C21H26N4OS+2 — CID 6977828
3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 6977828) has the molecular formula C21H26N4OS+2 and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 6977828 |
| Molecular Formula | C21H26N4OS+2 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1CC[NH+]1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N4OS/c26-20-18-8-4-5-9-19(18)22-21(27)25(20)15-14-23-10-12-24(13-11-23)16-17-6-2-1-3-7-17/h1-9H,10-16H2,(H,22,27)/p+2 |
| InChIKey | TUCFRBUGRXRJLV-UHFFFAOYSA-P |
| XLogP | 0.04 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|