C20H22N3OS+ — CID 2304312
2-sulfanylidene-3-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]-1H-quinazolin-4-one (PubChem CID 2304312) has the molecular formula C20H22N3OS+ and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-sulfanylidene-3-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]-1H-quinazolin-4-one.
| Compound Name | 2-sulfanylidene-3-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 2304312 |
| Molecular Formula | C20H22N3OS+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-sulfanylidene-3-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1CCC[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H21N3OS/c24-19-17-8-3-4-9-18(17)21-20(25)23(19)12-5-11-22-13-10-15-6-1-2-7-16(15)14-22/h1-4,6-9H,5,10-14H2,(H,21,25)/p+1 |
| InChIKey | BKBSHKMZYFVOMW-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|