C13H10Cl4NO4- — CID 6980634
2,3,4,5-tetrachloro-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]benzoate (PubChem CID 6980634) has the molecular formula C13H10Cl4NO4- and a molecular weight of 386.04 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]benzoate.
| Compound Name | 2,3,4,5-tetrachloro-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 6980634 |
| Molecular Formula | C13H10Cl4NO4- |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]benzoate |
| SMILES | O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H11Cl4NO4/c14-8-6(12(19)18-4-5-2-1-3-22-5)7(13(20)21)9(15)11(17)10(8)16/h5H,1-4H2,(H,18,19)(H,20,21)/p-1/t5-/m0/s1 |
| InChIKey | KEYACANAMKEDNQ-YFKPBYRVSA-M |
| XLogP | 2.57 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|