C16H19N2O2+ — CID 6982377
(3aS,4S,7aS)-4,6-dimethyl-2-(1-methylpyridin-1-ium-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 6982377) has the molecular formula C16H19N2O2+ and a molecular weight of 271.34 g/mol. Its IUPAC name is (3aS,4S,7aS)-4,6-dimethyl-2-(1-methylpyridin-1-ium-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aS)-4,6-dimethyl-2-(1-methylpyridin-1-ium-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6982377 |
| Molecular Formula | C16H19N2O2+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3aS,4S,7aS)-4,6-dimethyl-2-(1-methylpyridin-1-ium-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=C[C@H](C)[C@@H]2C(=O)N(c3ccc[n+](C)c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C16H19N2O2/c1-10-7-11(2)14-13(8-10)15(19)18(16(14)20)12-5-4-6-17(3)9-12/h4-7,9,11,13-14H,8H2,1-3H3/q+1/t11-,13-,14-/m0/s1 |
| InChIKey | UYHYCNHHAGZKQZ-UBHSHLNASA-N |
| XLogP | 1.60 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|