C16H27N2O2+ — CID 927436
3-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-trimethylazanium (PubChem CID 927436) has the molecular formula C16H27N2O2+ and a molecular weight of 279.40 g/mol. Its IUPAC name is 3-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-trimethylazanium.
| Compound Name | 3-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 927436 |
| Molecular Formula | C16H27N2O2+ |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 3-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-trimethylazanium |
| SMILES | CC1=C[C@@H](C)[C@H]2C(=O)N(CCC[N+](C)(C)C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C16H27N2O2/c1-11-9-12(2)14-13(10-11)15(19)17(16(14)20)7-6-8-18(3,4)5/h9,12-14H,6-8,10H2,1-5H3/q+1/t12-,13+,14-/m1/s1 |
| InChIKey | GOEBHGSAJXXUNJ-HZSPNIEDSA-N |
| XLogP | 1.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|