C22H22N2O6-2 — CID 6982576
2-(butanoylamino)-5-[4-(butanoylamino)-3-carboxylatophenyl]benzoate (PubChem CID 6982576) has the molecular formula C22H22N2O6-2 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-(butanoylamino)-5-[4-(butanoylamino)-3-carboxylatophenyl]benzoate.
| Compound Name | 2-(butanoylamino)-5-[4-(butanoylamino)-3-carboxylatophenyl]benzoate |
|---|---|
| PubChem CID | 6982576 |
| Molecular Formula | C22H22N2O6-2 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-(butanoylamino)-5-[4-(butanoylamino)-3-carboxylatophenyl]benzoate |
| SMILES | CCCC(=O)Nc1ccc(-c2ccc(NC(=O)CCC)c(C(=O)[O-])c2)cc1C(=O)[O-] |
| InChI | InChI=1S/C22H24N2O6/c1-3-5-19(25)23-17-9-7-13(11-15(17)21(27)28)14-8-10-18(16(12-14)22(29)30)24-20(26)6-4-2/h7-12H,3-6H2,1-2H3,(H,23,25)(H,24,26)(H,27,28)(H,29,30)/p-2 |
| InChIKey | BOORNHVHNLYANI-UHFFFAOYSA-L |
| XLogP | 1.56 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |