C6H7Br2O2- — CID 6984505
2-[(1S)-2,2-dibromo-1-methylcyclopropyl]acetate (PubChem CID 6984505) has the molecular formula C6H7Br2O2- and a molecular weight of 270.93 g/mol. Its IUPAC name is 2-[(1S)-2,2-dibromo-1-methylcyclopropyl]acetate.
| Compound Name | 2-[(1S)-2,2-dibromo-1-methylcyclopropyl]acetate |
|---|---|
| PubChem CID | 6984505 |
| Molecular Formula | C6H7Br2O2- |
| Molecular Weight | 270.93 g/mol |
| Exact Mass | 268.88 |
| IUPAC Name | 2-[(1S)-2,2-dibromo-1-methylcyclopropyl]acetate |
| SMILES | C[C@]1(CC(=O)[O-])CC1(Br)Br |
| InChI | InChI=1S/C6H8Br2O2/c1-5(2-4(9)10)3-6(5,7)8/h2-3H2,1H3,(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | BFZYHZSTXWAZIY-YFKPBYRVSA-M |
| XLogP | 1.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.93 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|