C22H22O6 — CID 6984640
(4S)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethoxyphenyl)methylidene]oxan-2-one (PubChem CID 6984640) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethoxyphenyl)methylidene]oxan-2-one.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethoxyphenyl)methylidene]oxan-2-one |
|---|---|
| PubChem CID | 6984640 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethoxyphenyl)methylidene]oxan-2-one |
| SMILES | COc1cc(C=C2C(=O)OCC[C@@H]2Cc2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C22H22O6/c1-24-17-8-15(9-18(12-17)25-2)10-19-16(5-6-26-22(19)23)7-14-3-4-20-21(11-14)28-13-27-20/h3-4,8-12,16H,5-7,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | VXDAICSZAATIKD-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|