C15H15N2O4- — CID 6985731
2-[(2-carbamoylphenyl)carbamoyl]cyclohexene-1-carboxylate (PubChem CID 6985731) has the molecular formula C15H15N2O4- and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[(2-carbamoylphenyl)carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | 2-[(2-carbamoylphenyl)carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 6985731 |
| Molecular Formula | C15H15N2O4- |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[(2-carbamoylphenyl)carbamoyl]cyclohexene-1-carboxylate |
| SMILES | NC(=O)c1ccccc1NC(=O)C1=C(C(=O)[O-])CCCC1 |
| InChI | InChI=1S/C15H16N2O4/c16-13(18)11-7-3-4-8-12(11)17-14(19)9-5-1-2-6-10(9)15(20)21/h3-4,7-8H,1-2,5-6H2,(H2,16,18)(H,17,19)(H,20,21)/p-1 |
| InChIKey | ZROLKUGRRKERHX-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |