C22H21FN3O2+ — CID 6988536
1-[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-phenylpiperidin-1-ium-4-carbonitrile (PubChem CID 6988536) has the molecular formula C22H21FN3O2+ and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-phenylpiperidin-1-ium-4-carbonitrile.
| Compound Name | 1-[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-phenylpiperidin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 6988536 |
| Molecular Formula | C22H21FN3O2+ |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-phenylpiperidin-1-ium-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CC[NH+]([C@H]2CC(=O)N(c3ccccc3F)C2=O)CC1 |
| InChI | InChI=1S/C22H20FN3O2/c23-17-8-4-5-9-18(17)26-20(27)14-19(21(26)28)25-12-10-22(15-24,11-13-25)16-6-2-1-3-7-16/h1-9,19H,10-14H2/p+1/t19-/m0/s1 |
| InChIKey | SBGYQVWRWHRDTG-IBGZPJMESA-O |
| XLogP | 1.60 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|