C7H14NO3+ — CID 6992701
ethyl (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate (PubChem CID 6992701) has the molecular formula C7H14NO3+ and a molecular weight of 160.19 g/mol. Its IUPAC name is ethyl (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate.
| Compound Name | ethyl (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 6992701 |
| Molecular Formula | C7H14NO3+ |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | ethyl (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](O)C[NH2+]1 |
| InChI | InChI=1S/C7H13NO3/c1-2-11-7(10)6-3-5(9)4-8-6/h5-6,8-9H,2-4H2,1H3/p+1/t5-,6-/m1/s1 |
| InChIKey | JMHQESARJMGVCZ-PHDIDXHHSA-O |
| XLogP | -1.75 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |