About methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride
methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride (PubChem CID 10866959) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride.
Analyze methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride?
The IUPAC name of methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride (CID 10866959) is methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride.
What is the SMILES notation for methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride?
The canonical SMILES for methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride is COC(=O)[C@@H]1C[C@@H](O)C[NH2+]1.[Cl-].
What is the InChIKey of methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride?
The InChIKey is KLGSHNXEUZOKHH-JBUOLDKXSA-N. The full InChI is InChI=1S/C6H11NO3.ClH/c1-10-6(9)5-2-4(8)3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4-,5+;/m1./s1.
What are the key properties of methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride?
methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride has a molecular weight of 181.62 g/mol, XLogP of -5.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylate chloride is sourced from PubChem (CID 10866959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).