C5H10NO3+ — CID 23248560
(2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylic acid (PubChem CID 23248560) has the molecular formula C5H10NO3+ and a molecular weight of 132.14 g/mol. Its IUPAC name is (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 23248560 |
| Molecular Formula | C5H10NO3+ |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | (2R,4R)-4-hydroxypyrrolidin-1-ium-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)C[NH2+]1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/p+1/t3-,4-/m1/s1 |
| InChIKey | PMMYEEVYMWASQN-QWWZWVQMSA-O |
| XLogP | -2.23 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |