C5H9NO3 — CID 5238478
4-hydroxypyrrolidin-1-ium-2-carboxylate (PubChem CID 5238478) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 4-hydroxypyrrolidin-1-ium-2-carboxylate.
| Compound Name | 4-hydroxypyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 5238478 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 4-hydroxypyrrolidin-1-ium-2-carboxylate |
| SMILES | O=C([O-])C1CC(O)C[NH2+]1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9) |
| InChIKey | PMMYEEVYMWASQN-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |