C13H13N2O3S- — CID 6993824
(1R,2S,3R,4S)-3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 6993824) has the molecular formula C13H13N2O3S- and a molecular weight of 277.32 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 6993824 |
| Molecular Formula | C13H13N2O3S- |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | Cc1csc(NC(=O)[C@H]2[C@@H](C(=O)[O-])[C@H]3C=C[C@@H]2C3)n1 |
| InChI | InChI=1S/C13H14N2O3S/c1-6-5-19-13(14-6)15-11(16)9-7-2-3-8(4-7)10(9)12(17)18/h2-3,5,7-10H,4H2,1H3,(H,17,18)(H,14,15,16)/p-1/t7-,8+,9-,10+/m1/s1 |
| InChIKey | XLLDXOLFVJYPTO-RGOKHQFPSA-M |
| XLogP | 0.58 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|