C15H24N4O4+2 — CID 6995892
2-morpholin-4-ium-4-ylethyl-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenyl]azanium (PubChem CID 6995892) has the molecular formula C15H24N4O4+2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-ylethyl-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenyl]azanium.
| Compound Name | 2-morpholin-4-ium-4-ylethyl-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenyl]azanium |
|---|---|
| PubChem CID | 6995892 |
| Molecular Formula | C15H24N4O4+2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-morpholin-4-ium-4-ylethyl-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenyl]azanium |
| SMILES | C=CCN1C(=O)NC(=O)[C@@H](C(=C)[NH2+]CC[NH+]2CCOCC2)C1=O |
| InChI | InChI=1S/C15H22N4O4/c1-3-5-19-14(21)12(13(20)17-15(19)22)11(2)16-4-6-18-7-9-23-10-8-18/h3,12,16H,1-2,4-10H2,(H,17,20,22)/p+2/t12-/m1/s1 |
| InChIKey | WMJZMPROFMWUFY-GFCCVEGCSA-P |
| XLogP | -3.14 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|