C18H20N4O4 — CID 2033763
N-[2-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenylamino]phenyl]propanamide (PubChem CID 2033763) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[2-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenylamino]phenyl]propanamide.
| Compound Name | N-[2-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 2033763 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[2-[1-[(5R)-2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl]ethenylamino]phenyl]propanamide |
| SMILES | C=CCN1C(=O)NC(=O)[C@@H](C(=C)Nc2ccccc2NC(=O)CC)C1=O |
| InChI | InChI=1S/C18H20N4O4/c1-4-10-22-17(25)15(16(24)21-18(22)26)11(3)19-12-8-6-7-9-13(12)20-14(23)5-2/h4,6-9,15,19H,1,3,5,10H2,2H3,(H,20,23)(H,21,24,26)/t15-/m1/s1 |
| InChIKey | XCIAQGUROKGCRE-OAHLLOKOSA-N |
| XLogP | 1.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|