C13H11NO4 — CID 835051
(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid (PubChem CID 835051) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid.
| Compound Name | (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 835051 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid |
| SMILES | C=CCN1C(=O)[C@@H](C(=O)O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H11NO4/c1-2-7-14-9-6-4-3-5-8(9)11(15)10(12(14)16)13(17)18/h2-6,10H,1,7H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | VNDRVBCBOASWAE-JTQLQIEISA-N |
| XLogP | 1.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|