(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid

C13H11NO4 — CID 835051

IUPAC(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid
SMILESC=CCN1C(=O)[C@@H](C(=O)O)C(=O)c2ccccc21
InChIInChI=1S/C13H11NO4/c1-2-7-14-9-6-4-3-5-8(9)11(15)10(12(14)16)13(17)18/h2-6,10H,1,7H2,(H,17,18)/t10-/m0/s1
InChIKeyVNDRVBCBOASWAE-JTQLQIEISA-N
MW245.23 g/mol
LogP1.10
Rot. Bonds3

About (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid

(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid (PubChem CID 835051) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid.

Molecular Properties

Compound Name(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid
PubChem CID835051
Molecular FormulaC13H11NO4
Molecular Weight245.23 g/mol
Exact Mass245.07
IUPAC Name(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid
SMILESC=CCN1C(=O)[C@@H](C(=O)O)C(=O)c2ccccc21
InChIInChI=1S/C13H11NO4/c1-2-7-14-9-6-4-3-5-8(9)11(15)10(12(14)16)13(17)18/h2-6,10H,1,7H2,(H,17,18)/t10-/m0/s1
InChIKeyVNDRVBCBOASWAE-JTQLQIEISA-N
XLogP1.10
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.23
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid?
The IUPAC name of (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid (CID 835051) is (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid.
What is the SMILES notation for (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid?
The canonical SMILES for (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid is C=CCN1C(=O)[C@@H](C(=O)O)C(=O)c2ccccc21.
What is the InChIKey of (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid?
The InChIKey is VNDRVBCBOASWAE-JTQLQIEISA-N. The full InChI is InChI=1S/C13H11NO4/c1-2-7-14-9-6-4-3-5-8(9)11(15)10(12(14)16)13(17)18/h2-6,10H,1,7H2,(H,17,18)/t10-/m0/s1.
What are the key properties of (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid?
(3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid has a molecular weight of 245.23 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,4-dioxo-1-prop-2-enylquinoline-3-carboxylic acid is sourced from PubChem (CID 835051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).