C12H10NO4- — CID 7020698
(3R)-1-ethyl-2,4-dioxoquinoline-3-carboxylate (PubChem CID 7020698) has the molecular formula C12H10NO4- and a molecular weight of 232.21 g/mol. Its IUPAC name is (3R)-1-ethyl-2,4-dioxoquinoline-3-carboxylate.
| Compound Name | (3R)-1-ethyl-2,4-dioxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7020698 |
| Molecular Formula | C12H10NO4- |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (3R)-1-ethyl-2,4-dioxoquinoline-3-carboxylate |
| SMILES | CCN1C(=O)[C@H](C(=O)[O-])C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H11NO4/c1-2-13-8-6-4-3-5-7(8)10(14)9(11(13)15)12(16)17/h3-6,9H,2H2,1H3,(H,16,17)/p-1/t9-/m1/s1 |
| InChIKey | UPBVPTNGSNMCQH-SECBINFHSA-M |
| XLogP | -0.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|